C27H24ClNO4 — CID 95021218
[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 3-chlorobenzoate (PubChem CID 95021218) has the molecular formula C27H24ClNO4 and a molecular weight of 461.95 g/mol. Its IUPAC name is [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 3-chlorobenzoate.
| Compound Name | [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 95021218 |
| Molecular Formula | C27H24ClNO4 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 3-chlorobenzoate |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3cc(OC(=O)c4cccc(Cl)c4)cc(C)c3C2=O)cc1 |
| InChI | InChI=1S/C27H24ClNO4/c1-4-29(5-2)21-11-9-18(10-12-21)14-24-26(30)25-17(3)13-22(16-23(25)33-24)32-27(31)19-7-6-8-20(28)15-19/h6-16H,4-5H2,1-3H3/b24-14- |
| InChIKey | ZTJQPMSVBLMUGW-OYKKKHCWSA-N |
| XLogP | 6.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|