C29H29NO5 — CID 95022132
benzyl 2-[[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl]oxy]acetate (PubChem CID 95022132) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is benzyl 2-[[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl]oxy]acetate.
| Compound Name | benzyl 2-[[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 95022132 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | benzyl 2-[[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl]oxy]acetate |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3cc(OCC(=O)OCc4ccccc4)cc(C)c3C2=O)cc1 |
| InChI | InChI=1S/C29H29NO5/c1-4-30(5-2)23-13-11-21(12-14-23)16-26-29(32)28-20(3)15-24(17-25(28)35-26)33-19-27(31)34-18-22-9-7-6-8-10-22/h6-17H,4-5,18-19H2,1-3H3/b26-16- |
| InChIKey | YRESNLGHLNKQNC-QQXSKIMKSA-N |
| XLogP | 5.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|