C25H14Br2O5 — CID 95398379
[(2Z)-2-[(4-bromophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate (PubChem CID 95398379) has the molecular formula C25H14Br2O5 and a molecular weight of 554.19 g/mol. Its IUPAC name is [(2Z)-2-[(4-bromophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate.
| Compound Name | [(2Z)-2-[(4-bromophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 95398379 |
| Molecular Formula | C25H14Br2O5 |
| Molecular Weight | 554.19 g/mol |
| Exact Mass | 551.92 |
| IUPAC Name | [(2Z)-2-[(4-bromophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(OC(=O)c2cc3cc(Br)ccc3o2)ccc2c1O/C(=C\c1ccc(Br)cc1)C2=O |
| InChI | InChI=1S/C25H14Br2O5/c1-13-19(32-25(29)22-12-15-11-17(27)6-8-20(15)30-22)9-7-18-23(28)21(31-24(13)18)10-14-2-4-16(26)5-3-14/h2-12H,1H3/b21-10- |
| InChIKey | INLROCMUGXQFOO-FBHDLOMBSA-N |
| XLogP | 7.10 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.19 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|