C23H23ClO4 — CID 110274536
[(2Z)-2-[(4-tert-butylphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-chloropropanoate (PubChem CID 110274536) has the molecular formula C23H23ClO4 and a molecular weight of 398.89 g/mol. Its IUPAC name is [(2Z)-2-[(4-tert-butylphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-chloropropanoate.
| Compound Name | [(2Z)-2-[(4-tert-butylphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-chloropropanoate |
|---|---|
| PubChem CID | 110274536 |
| Molecular Formula | C23H23ClO4 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [(2Z)-2-[(4-tert-butylphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-chloropropanoate |
| SMILES | Cc1c(OC(=O)C(C)Cl)ccc2c1O/C(=C\c1ccc(C(C)(C)C)cc1)C2=O |
| InChI | InChI=1S/C23H23ClO4/c1-13-18(28-22(26)14(2)24)11-10-17-20(25)19(27-21(13)17)12-15-6-8-16(9-7-15)23(3,4)5/h6-12,14H,1-5H3/b19-12- |
| InChIKey | QTLJYNQJGHKWRB-UNOMPAQXSA-N |
| XLogP | 5.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|