C24H16ClFO4 — CID 110274228
[(2Z)-2-[(3-fluorophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate (PubChem CID 110274228) has the molecular formula C24H16ClFO4 and a molecular weight of 422.84 g/mol. Its IUPAC name is [(2Z)-2-[(3-fluorophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate.
| Compound Name | [(2Z)-2-[(3-fluorophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate |
|---|---|
| PubChem CID | 110274228 |
| Molecular Formula | C24H16ClFO4 |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | [(2Z)-2-[(3-fluorophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate |
| SMILES | Cc1c(OC(=O)C(Cl)c2ccccc2)ccc2c1O/C(=C\c1cccc(F)c1)C2=O |
| InChI | InChI=1S/C24H16ClFO4/c1-14-19(30-24(28)21(25)16-7-3-2-4-8-16)11-10-18-22(27)20(29-23(14)18)13-15-6-5-9-17(26)12-15/h2-13,21H,1H3/b20-13- |
| InChIKey | MJVJFHZAFXEEFZ-MOSHPQCFSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|