C31H33NO4 — CID 95018331
[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 4-tert-butylbenzoate (PubChem CID 95018331) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 4-tert-butylbenzoate.
| Compound Name | [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 95018331 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 4-tert-butylbenzoate |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3c(ccc(OC(=O)c4ccc(C(C)(C)C)cc4)c3C)C2=O)cc1 |
| InChI | InChI=1S/C31H33NO4/c1-7-32(8-2)24-15-9-21(10-16-24)19-27-28(33)25-17-18-26(20(3)29(25)35-27)36-30(34)22-11-13-23(14-12-22)31(4,5)6/h9-19H,7-8H2,1-6H3/b27-19- |
| InChIKey | YCFXTXSEWNTTTL-DIBXZPPDSA-N |
| XLogP | 6.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|