C27H25ClFNO3 — CID 95023394
(2Z)-6-[(2-chloro-4-fluorophenyl)methoxy]-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-1-benzofuran-3-one (PubChem CID 95023394) has the molecular formula C27H25ClFNO3 and a molecular weight of 465.95 g/mol. Its IUPAC name is (2Z)-6-[(2-chloro-4-fluorophenyl)methoxy]-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(2-chloro-4-fluorophenyl)methoxy]-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95023394 |
| Molecular Formula | C27H25ClFNO3 |
| Molecular Weight | 465.95 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (2Z)-6-[(2-chloro-4-fluorophenyl)methoxy]-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-1-benzofuran-3-one |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3c(ccc(OCc4ccc(F)cc4Cl)c3C)C2=O)cc1 |
| InChI | InChI=1S/C27H25ClFNO3/c1-4-30(5-2)21-10-6-18(7-11-21)14-25-26(31)22-12-13-24(17(3)27(22)33-25)32-16-19-8-9-20(29)15-23(19)28/h6-15H,4-5,16H2,1-3H3/b25-14- |
| InChIKey | HIEFWVQZPJDWHA-QFEZKATASA-N |
| XLogP | 6.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.95 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|