C29H28BrNO5 — CID 95398841
(2Z)-6-[(6-bromo-4H-1,3-benzodioxin-8-yl)methoxy]-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-1-benzofuran-3-one (PubChem CID 95398841) has the molecular formula C29H28BrNO5 and a molecular weight of 550.45 g/mol. Its IUPAC name is (2Z)-6-[(6-bromo-4H-1,3-benzodioxin-8-yl)methoxy]-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(6-bromo-4H-1,3-benzodioxin-8-yl)methoxy]-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95398841 |
| Molecular Formula | C29H28BrNO5 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | (2Z)-6-[(6-bromo-4H-1,3-benzodioxin-8-yl)methoxy]-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-1-benzofuran-3-one |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3c(ccc(OCc4cc(Br)cc5c4OCOC5)c3C)C2=O)cc1 |
| InChI | InChI=1S/C29H28BrNO5/c1-4-31(5-2)23-8-6-19(7-9-23)12-26-27(32)24-10-11-25(18(3)28(24)36-26)34-16-21-14-22(30)13-20-15-33-17-35-29(20)21/h6-14H,4-5,15-17H2,1-3H3/b26-12- |
| InChIKey | FIXOUAXOLXGJSB-ZRGSRPPYSA-N |
| XLogP | 6.67 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|