C27H24BrNO4 — CID 95018322
[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-bromobenzoate (PubChem CID 95018322) has the molecular formula C27H24BrNO4 and a molecular weight of 506.40 g/mol. Its IUPAC name is [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-bromobenzoate.
| Compound Name | [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-bromobenzoate |
|---|---|
| PubChem CID | 95018322 |
| Molecular Formula | C27H24BrNO4 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-bromobenzoate |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3c(ccc(OC(=O)c4ccccc4Br)c3C)C2=O)cc1 |
| InChI | InChI=1S/C27H24BrNO4/c1-4-29(5-2)19-12-10-18(11-13-19)16-24-25(30)21-14-15-23(17(3)26(21)32-24)33-27(31)20-8-6-7-9-22(20)28/h6-16H,4-5H2,1-3H3/b24-16- |
| InChIKey | OMIGNEKVIGMLPB-JLPGSUDCSA-N |
| XLogP | 6.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|