C25H16BrClO6 — CID 95397707
[(2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-bromobenzoate (PubChem CID 95397707) has the molecular formula C25H16BrClO6 and a molecular weight of 527.75 g/mol. Its IUPAC name is [(2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-bromobenzoate.
| Compound Name | [(2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-bromobenzoate |
|---|---|
| PubChem CID | 95397707 |
| Molecular Formula | C25H16BrClO6 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | [(2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-bromobenzoate |
| SMILES | Cc1c(OC(=O)c2ccccc2Br)ccc2c1O/C(=C\c1cc(Cl)cc3c1OCOC3)C2=O |
| InChI | InChI=1S/C25H16BrClO6/c1-13-20(33-25(29)17-4-2-3-5-19(17)26)7-6-18-22(28)21(32-23(13)18)10-14-8-16(27)9-15-11-30-12-31-24(14)15/h2-10H,11-12H2,1H3/b21-10- |
| InChIKey | NILUQVYIBNMIKZ-FBHDLOMBSA-N |
| XLogP | 6.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|