C23H19ClO7 — CID 110274849
[(2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate (PubChem CID 110274849) has the molecular formula C23H19ClO7 and a molecular weight of 442.85 g/mol. Its IUPAC name is [(2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate.
| Compound Name | [(2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 110274849 |
| Molecular Formula | C23H19ClO7 |
| Molecular Weight | 442.85 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | [(2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
| SMILES | Cc1c(OC(=O)C2CCCO2)ccc2c1O/C(=C\c1cc(Cl)cc3c1OCOC3)C2=O |
| InChI | InChI=1S/C23H19ClO7/c1-12-17(31-23(26)18-3-2-6-28-18)5-4-16-20(25)19(30-21(12)16)9-13-7-15(24)8-14-10-27-11-29-22(13)14/h4-5,7-9,18H,2-3,6,10-11H2,1H3/b19-9- |
| InChIKey | METYNUKLBMIZAV-OCKHKDLRSA-N |
| XLogP | 4.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|