C23H22O6 — CID 110274821
[(2Z)-2-[(4-ethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate (PubChem CID 110274821) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is [(2Z)-2-[(4-ethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate.
| Compound Name | [(2Z)-2-[(4-ethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 110274821 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [(2Z)-2-[(4-ethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
| SMILES | CCOc1ccc(/C=C2\Oc3c(ccc(OC(=O)C4CCCO4)c3C)C2=O)cc1 |
| InChI | InChI=1S/C23H22O6/c1-3-26-16-8-6-15(7-9-16)13-20-21(24)17-10-11-18(14(2)22(17)28-20)29-23(25)19-5-4-12-27-19/h6-11,13,19H,3-5,12H2,1-2H3/b20-13- |
| InChIKey | NZOOSKWINXEZKR-MOSHPQCFSA-N |
| XLogP | 4.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|