C26H25NO6 — CID 110274853
[(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate (PubChem CID 110274853) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is [(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate.
| Compound Name | [(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 110274853 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
| SMILES | CCn1cc(/C=C2\Oc3c(ccc(OC(=O)C4CCCO4)c3C)C2=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C26H25NO6/c1-4-27-14-16(19-13-17(30-3)7-9-20(19)27)12-23-24(28)18-8-10-21(15(2)25(18)32-23)33-26(29)22-6-5-11-31-22/h7-10,12-14,22H,4-6,11H2,1-3H3/b23-12- |
| InChIKey | NIWBJUHYUQLELB-FMCGGJTJSA-N |
| XLogP | 4.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|