C28H22ClNO5 — CID 110274361
[(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate (PubChem CID 110274361) has the molecular formula C28H22ClNO5 and a molecular weight of 487.94 g/mol. Its IUPAC name is [(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate.
| Compound Name | [(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate |
|---|---|
| PubChem CID | 110274361 |
| Molecular Formula | C28H22ClNO5 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | [(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate |
| SMILES | CCn1cc(/C=C2\Oc3cc(OC(=O)C(Cl)c4ccccc4)ccc3C2=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C28H22ClNO5/c1-3-30-16-18(22-14-19(33-2)10-12-23(22)30)13-25-27(31)21-11-9-20(15-24(21)35-25)34-28(32)26(29)17-7-5-4-6-8-17/h4-16,26H,3H2,1-2H3/b25-13- |
| InChIKey | GRONBLZYCJGGPC-MXAYSNPKSA-N |
| XLogP | 6.17 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|