C21H18N2O4 — CID 35494253
2-[[(2Z)-2-[(1-ethylindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide (PubChem CID 35494253) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[[(2Z)-2-[(1-ethylindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide.
| Compound Name | 2-[[(2Z)-2-[(1-ethylindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 35494253 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[[(2Z)-2-[(1-ethylindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide |
| SMILES | CCn1cc(/C=C2\Oc3cc(OCC(N)=O)ccc3C2=O)c2ccccc21 |
| InChI | InChI=1S/C21H18N2O4/c1-2-23-11-13(15-5-3-4-6-17(15)23)9-19-21(25)16-8-7-14(10-18(16)27-19)26-12-20(22)24/h3-11H,2,12H2,1H3,(H2,22,24)/b19-9- |
| InChIKey | SCLVIGXZHCWWQZ-OCKHKDLRSA-N |
| XLogP | 3.14 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|