C28H22BrNO5 — CID 95398714
(2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 95398714) has the molecular formula C28H22BrNO5 and a molecular weight of 532.39 g/mol. Its IUPAC name is (2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95398714 |
| Molecular Formula | C28H22BrNO5 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | (2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | CCn1cc(/C=C2\Oc3cc(OCC(=O)c4ccc(Br)cc4)ccc3C2=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C28H22BrNO5/c1-3-30-15-18(23-13-20(33-2)9-11-24(23)30)12-27-28(32)22-10-8-21(14-26(22)35-27)34-16-25(31)17-4-6-19(29)7-5-17/h4-15H,3,16H2,1-2H3/b27-12- |
| InChIKey | ZXVAXSITTOTXQO-PPDIBHTLSA-N |
| XLogP | 6.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|