C28H25NO5 — CID 35494063
(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one (PubChem CID 35494063) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is (2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 35494063 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one |
| SMILES | CCn1cc(/C=C2\Oc3cc(OCc4ccc(OC)cc4)ccc3C2=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C28H25NO5/c1-4-29-16-19(24-14-21(32-3)10-12-25(24)29)13-27-28(30)23-11-9-22(15-26(23)34-27)33-17-18-5-7-20(31-2)8-6-18/h5-16H,4,17H2,1-3H3/b27-13- |
| InChIKey | YRUQNBZGXSDCKU-WKIKZPBSSA-N |
| XLogP | 5.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|