C25H22O4 — CID 6532638
(2Z)-2-[(4-ethylphenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one (PubChem CID 6532638) has the molecular formula C25H22O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is (2Z)-2-[(4-ethylphenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(4-ethylphenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6532638 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (2Z)-2-[(4-ethylphenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one |
| SMILES | CCc1ccc(/C=C2\Oc3cc(OCc4ccc(OC)cc4)ccc3C2=O)cc1 |
| InChI | InChI=1S/C25H22O4/c1-3-17-4-6-18(7-5-17)14-24-25(26)22-13-12-21(15-23(22)29-24)28-16-19-8-10-20(27-2)11-9-19/h4-15H,3,16H2,1-2H3/b24-14- |
| InChIKey | KMUAZSZJFZFXCC-OYKKKHCWSA-N |
| XLogP | 5.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|