C23H17FO4 — CID 6220541
(2Z)-2-[(3-fluorophenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one (PubChem CID 6220541) has the molecular formula C23H17FO4 and a molecular weight of 376.38 g/mol. Its IUPAC name is (2Z)-2-[(3-fluorophenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(3-fluorophenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6220541 |
| Molecular Formula | C23H17FO4 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (2Z)-2-[(3-fluorophenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one |
| SMILES | COc1ccc(COc2ccc3c(c2)O/C(=C\c2cccc(F)c2)C3=O)cc1 |
| InChI | InChI=1S/C23H17FO4/c1-26-18-7-5-15(6-8-18)14-27-19-9-10-20-21(13-19)28-22(23(20)25)12-16-3-2-4-17(24)11-16/h2-13H,14H2,1H3/b22-12- |
| InChIKey | VSBNAJZDJIORMW-UUYOSTAYSA-N |
| XLogP | 5.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|