C17H11FO5 — CID 4975050
2-[[2-[(3-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetic acid (PubChem CID 4975050) has the molecular formula C17H11FO5 and a molecular weight of 314.27 g/mol. Its IUPAC name is 2-[[2-[(3-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetic acid.
| Compound Name | 2-[[2-[(3-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 4975050 |
| Molecular Formula | C17H11FO5 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-[[2-[(3-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1ccc2c(c1)OC(=Cc1cccc(F)c1)C2=O |
| InChI | InChI=1S/C17H11FO5/c18-11-3-1-2-10(6-11)7-15-17(21)13-5-4-12(8-14(13)23-15)22-9-16(19)20/h1-8H,9H2,(H,19,20) |
| InChIKey | FVRDOSBEKUYWHU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|