C20H17FO3 — CID 2016141
(2Z)-2-[(3-fluorophenyl)methylidene]-6-(3-methylbut-2-enoxy)-1-benzofuran-3-one (PubChem CID 2016141) has the molecular formula C20H17FO3 and a molecular weight of 324.35 g/mol. Its IUPAC name is (2Z)-2-[(3-fluorophenyl)methylidene]-6-(3-methylbut-2-enoxy)-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(3-fluorophenyl)methylidene]-6-(3-methylbut-2-enoxy)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2016141 |
| Molecular Formula | C20H17FO3 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (2Z)-2-[(3-fluorophenyl)methylidene]-6-(3-methylbut-2-enoxy)-1-benzofuran-3-one |
| SMILES | CC(C)=CCOc1ccc2c(c1)O/C(=C\c1cccc(F)c1)C2=O |
| InChI | InChI=1S/C20H17FO3/c1-13(2)8-9-23-16-6-7-17-18(12-16)24-19(20(17)22)11-14-4-3-5-15(21)10-14/h3-8,10-12H,9H2,1-2H3/b19-11- |
| InChIKey | RSBMIQOGWNPOPL-ODLFYWEKSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|