C23H17ClO4 — CID 4861252
2-[(3-chlorophenyl)methylidene]-6-[(3-methoxyphenyl)methoxy]-1-benzofuran-3-one (PubChem CID 4861252) has the molecular formula C23H17ClO4 and a molecular weight of 392.84 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylidene]-6-[(3-methoxyphenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | 2-[(3-chlorophenyl)methylidene]-6-[(3-methoxyphenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4861252 |
| Molecular Formula | C23H17ClO4 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[(3-chlorophenyl)methylidene]-6-[(3-methoxyphenyl)methoxy]-1-benzofuran-3-one |
| SMILES | COc1cccc(COc2ccc3c(c2)OC(=Cc2cccc(Cl)c2)C3=O)c1 |
| InChI | InChI=1S/C23H17ClO4/c1-26-18-7-3-5-16(11-18)14-27-19-8-9-20-21(13-19)28-22(23(20)25)12-15-4-2-6-17(24)10-15/h2-13H,14H2,1H3 |
| InChIKey | NTFHOJIUEQCBGG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|