C22H15ClO4 — CID 177377469
(2Z)-2-[[3-[(3-chlorophenyl)methoxy]phenyl]methylidene]-6-hydroxy-1-benzofuran-3-one (PubChem CID 177377469) has the molecular formula C22H15ClO4 and a molecular weight of 378.81 g/mol. Its IUPAC name is (2Z)-2-[[3-[(3-chlorophenyl)methoxy]phenyl]methylidene]-6-hydroxy-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[[3-[(3-chlorophenyl)methoxy]phenyl]methylidene]-6-hydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 177377469 |
| Molecular Formula | C22H15ClO4 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2Z)-2-[[3-[(3-chlorophenyl)methoxy]phenyl]methylidene]-6-hydroxy-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2cccc(OCc3cccc(Cl)c3)c2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H15ClO4/c23-16-5-1-4-15(9-16)13-26-18-6-2-3-14(10-18)11-21-22(25)19-8-7-17(24)12-20(19)27-21/h1-12,24H,13H2/b21-11- |
| InChIKey | UXPLUBCJOXYHRI-NHDPSOOVSA-N |
| XLogP | 5.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|