C27H30N2O4 — CID 35494317
(2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-6-hydroxy-7-[[(3S)-3-methylpiperidin-1-yl]methyl]-1-benzofuran-3-one (PubChem CID 35494317) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is (2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-6-hydroxy-7-[[(3S)-3-methylpiperidin-1-yl]methyl]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-6-hydroxy-7-[[(3S)-3-methylpiperidin-1-yl]methyl]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 35494317 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (2Z)-2-[(1-ethyl-5-methoxyindol-3-yl)methylidene]-6-hydroxy-7-[[(3S)-3-methylpiperidin-1-yl]methyl]-1-benzofuran-3-one |
| SMILES | CCn1cc(/C=C2\Oc3c(ccc(O)c3CN3CCC[C@H](C)C3)C2=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C27H30N2O4/c1-4-29-15-18(21-13-19(32-3)7-9-23(21)29)12-25-26(31)20-8-10-24(30)22(27(20)33-25)16-28-11-5-6-17(2)14-28/h7-10,12-13,15,17,30H,4-6,11,14,16H2,1-3H3/b25-12-/t17-/m0/s1 |
| InChIKey | CYWOHMRXGGESRQ-MHBHXDGASA-N |
| XLogP | 5.22 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|