C27H30N2O4 — CID 35493957
(2Z)-7-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 35493957) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is (2Z)-7-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-7-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 35493957 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (2Z)-7-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc2c(c1)c(/C=C1\Oc3c(ccc(O)c3CN3C[C@H](C)C[C@@H](C)C3)C1=O)cn2C |
| InChI | InChI=1S/C27H30N2O4/c1-16-9-17(2)13-29(12-16)15-22-24(30)8-6-20-26(31)25(33-27(20)22)10-18-14-28(3)23-7-5-19(32-4)11-21(18)23/h5-8,10-11,14,16-17,30H,9,12-13,15H2,1-4H3/b25-10-/t16-,17-/m1/s1 |
| InChIKey | VKYHRZAQGUHHKK-RSAKMCAJSA-N |
| XLogP | 4.99 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|