C26H28N2O3 — CID 35493918
(2Z)-7-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 35493918) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2Z)-7-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-7-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 35493918 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2Z)-7-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-6-hydroxy-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | C[C@@H]1C[C@@H](C)CN(Cc2c(O)ccc3c2O/C(=C\c2cn(C)c4ccccc24)C3=O)C1 |
| InChI | InChI=1S/C26H28N2O3/c1-16-10-17(2)13-28(12-16)15-21-23(29)9-8-20-25(30)24(31-26(20)21)11-18-14-27(3)22-7-5-4-6-19(18)22/h4-9,11,14,16-17,29H,10,12-13,15H2,1-3H3/b24-11-/t16-,17-/m1/s1 |
| InChIKey | IHGLGZSYDZUANB-SJJGZAMRSA-N |
| XLogP | 4.98 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|