C25H14ClF5O5 — CID 95398643
(2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one (PubChem CID 95398643) has the molecular formula C25H14ClF5O5 and a molecular weight of 524.83 g/mol. Its IUPAC name is (2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95398643 |
| Molecular Formula | C25H14ClF5O5 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | (2Z)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-7-methyl-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one |
| SMILES | Cc1c(OCc2c(F)c(F)c(F)c(F)c2F)ccc2c1O/C(=C\c1cc(Cl)cc3c1OCOC3)C2=O |
| InChI | InChI=1S/C25H14ClF5O5/c1-10-16(34-8-15-18(27)20(29)22(31)21(30)19(15)28)3-2-14-23(32)17(36-24(10)14)6-11-4-13(26)5-12-7-33-9-35-25(11)12/h2-6H,7-9H2,1H3/b17-6- |
| InChIKey | LGTSAJKEWLJFRZ-FMQZQXMHSA-N |
| XLogP | 6.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|