C27H22ClNO3 — CID 35494048
(2Z)-6-[(2-chlorophenyl)methoxy]-2-[(1-ethylindol-3-yl)methylidene]-7-methyl-1-benzofuran-3-one (PubChem CID 35494048) has the molecular formula C27H22ClNO3 and a molecular weight of 443.93 g/mol. Its IUPAC name is (2Z)-6-[(2-chlorophenyl)methoxy]-2-[(1-ethylindol-3-yl)methylidene]-7-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(2-chlorophenyl)methoxy]-2-[(1-ethylindol-3-yl)methylidene]-7-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 35494048 |
| Molecular Formula | C27H22ClNO3 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (2Z)-6-[(2-chlorophenyl)methoxy]-2-[(1-ethylindol-3-yl)methylidene]-7-methyl-1-benzofuran-3-one |
| SMILES | CCn1cc(/C=C2\Oc3c(ccc(OCc4ccccc4Cl)c3C)C2=O)c2ccccc21 |
| InChI | InChI=1S/C27H22ClNO3/c1-3-29-15-19(20-9-5-7-11-23(20)29)14-25-26(30)21-12-13-24(17(2)27(21)32-25)31-16-18-8-4-6-10-22(18)28/h4-15H,3,16H2,1-2H3/b25-14- |
| InChIKey | JTYFRPCPTDKOQO-QFEZKATASA-N |
| XLogP | 6.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|