C26H19Cl2NO3 — CID 35494107
(2Z)-6-[(2,4-dichlorophenyl)methoxy]-7-methyl-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 35494107) has the molecular formula C26H19Cl2NO3 and a molecular weight of 464.35 g/mol. Its IUPAC name is (2Z)-6-[(2,4-dichlorophenyl)methoxy]-7-methyl-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(2,4-dichlorophenyl)methoxy]-7-methyl-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 35494107 |
| Molecular Formula | C26H19Cl2NO3 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | (2Z)-6-[(2,4-dichlorophenyl)methoxy]-7-methyl-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1c(OCc2ccc(Cl)cc2Cl)ccc2c1O/C(=C\c1cn(C)c3ccccc13)C2=O |
| InChI | InChI=1S/C26H19Cl2NO3/c1-15-23(31-14-16-7-8-18(27)12-21(16)28)10-9-20-25(30)24(32-26(15)20)11-17-13-29(2)22-6-4-3-5-19(17)22/h3-13H,14H2,1-2H3/b24-11- |
| InChIKey | QFXMEOSEUWCJDB-MYKKPKGFSA-N |
| XLogP | 6.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|