C22H21NO6 — CID 4887897
[2-(1,3-benzodioxol-5-ylmethylidene)-7-methyl-3-oxo-1-benzofuran-6-yl] N,N-diethylcarbamate (PubChem CID 4887897) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylidene)-7-methyl-3-oxo-1-benzofuran-6-yl] N,N-diethylcarbamate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylidene)-7-methyl-3-oxo-1-benzofuran-6-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 4887897 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylidene)-7-methyl-3-oxo-1-benzofuran-6-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(c1C)OC(=Cc1ccc3c(c1)OCO3)C2=O |
| InChI | InChI=1S/C22H21NO6/c1-4-23(5-2)22(25)29-16-9-7-15-20(24)19(28-21(15)13(16)3)11-14-6-8-17-18(10-14)27-12-26-17/h6-11H,4-5,12H2,1-3H3 |
| InChIKey | SCDNONKTEQLSFS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|