C19H18NO5+ — CID 7003125
[2-(1,3-benzodioxol-5-ylmethylidene)-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl-dimethylazanium (PubChem CID 7003125) has the molecular formula C19H18NO5+ and a molecular weight of 340.36 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylidene)-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl-dimethylazanium.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylidene)-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 7003125 |
| Molecular Formula | C19H18NO5+ |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylidene)-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1c(O)ccc2c1OC(=Cc1ccc3c(c1)OCO3)C2=O |
| InChI | InChI=1S/C19H17NO5/c1-20(2)9-13-14(21)5-4-12-18(22)17(25-19(12)13)8-11-3-6-15-16(7-11)24-10-23-15/h3-8,21H,9-10H2,1-2H3/p+1 |
| InChIKey | IIJIMZPTGXYAEX-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 69.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|