C27H18O8 — CID 176586158
(2E)-9-(1,3-benzodioxol-5-yl)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 176586158) has the molecular formula C27H18O8 and a molecular weight of 470.43 g/mol. Its IUPAC name is (2E)-9-(1,3-benzodioxol-5-yl)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2E)-9-(1,3-benzodioxol-5-yl)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 176586158 |
| Molecular Formula | C27H18O8 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (2E)-9-(1,3-benzodioxol-5-yl)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1CC(c2ccc3c(c2)OCO3)c2c(ccc3c2O/C(=C/c2ccc4c(c2)OCCO4)C3=O)O1 |
| InChI | InChI=1S/C27H18O8/c28-24-12-17(15-2-5-19-22(11-15)33-13-32-19)25-20(34-24)6-3-16-26(29)23(35-27(16)25)10-14-1-4-18-21(9-14)31-8-7-30-18/h1-6,9-11,17H,7-8,12-13H2/b23-10+ |
| InChIKey | VWEGDNUXFOJLOT-AUEPDCJTSA-N |
| XLogP | 4.24 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|