C29H18O8 — CID 176586165
(2E)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 176586165) has the molecular formula C29H18O8 and a molecular weight of 494.46 g/mol. Its IUPAC name is (2E)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2E)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 176586165 |
| Molecular Formula | C29H18O8 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | (2E)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1CC(c2coc3ccccc3c2=O)c2c(ccc3c2O/C(=C/c2ccc4c(c2)OCCO4)C3=O)O1 |
| InChI | InChI=1S/C29H18O8/c30-25-13-18(19-14-35-20-4-2-1-3-16(20)27(19)31)26-22(36-25)8-6-17-28(32)24(37-29(17)26)12-15-5-7-21-23(11-15)34-10-9-33-21/h1-8,11-12,14,18H,9-10,13H2/b24-12+ |
| InChIKey | WONSVGCMJFJESM-WYMPLXKRSA-N |
| XLogP | 4.62 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|