C29H20O7 — CID 91637481
(2Z)-2-[(4-methoxyphenyl)methylidene]-9-(6-methyl-4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 91637481) has the molecular formula C29H20O7 and a molecular weight of 480.47 g/mol. Its IUPAC name is (2Z)-2-[(4-methoxyphenyl)methylidene]-9-(6-methyl-4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z)-2-[(4-methoxyphenyl)methylidene]-9-(6-methyl-4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 91637481 |
| Molecular Formula | C29H20O7 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | (2Z)-2-[(4-methoxyphenyl)methylidene]-9-(6-methyl-4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc4c3C(c3coc5ccc(C)cc5c3=O)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C29H20O7/c1-15-3-9-22-20(11-15)27(31)21(14-34-22)19-13-25(30)35-23-10-8-18-28(32)24(36-29(18)26(19)23)12-16-4-6-17(33-2)7-5-16/h3-12,14,19H,13H2,1-2H3/b24-12- |
| InChIKey | AIAIGNNBZFUUSD-MSXFZWOLSA-N |
| XLogP | 5.17 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|