C29H20O8 — CID 163088766
9-(6-methoxy-4-oxochromen-3-yl)-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 163088766) has the molecular formula C29H20O8 and a molecular weight of 496.47 g/mol. Its IUPAC name is 9-(6-methoxy-4-oxochromen-3-yl)-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 9-(6-methoxy-4-oxochromen-3-yl)-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 163088766 |
| Molecular Formula | C29H20O8 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 9-(6-methoxy-4-oxochromen-3-yl)-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(C=C2Oc3c(ccc4c3C(c3coc5ccc(OC)cc5c3=O)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C29H20O8/c1-33-16-5-3-15(4-6-16)11-24-28(32)18-8-10-23-26(29(18)37-24)19(13-25(30)36-23)21-14-35-22-9-7-17(34-2)12-20(22)27(21)31/h3-12,14,19H,13H2,1-2H3 |
| InChIKey | AWVHHTYYWOKNCS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|