C30H22O6 — CID 125432546
(2Z,9R)-9-(4-oxochromen-3-yl)-2-[(4-propan-2-ylphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125432546) has the molecular formula C30H22O6 and a molecular weight of 478.50 g/mol. Its IUPAC name is (2Z,9R)-9-(4-oxochromen-3-yl)-2-[(4-propan-2-ylphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-(4-oxochromen-3-yl)-2-[(4-propan-2-ylphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125432546 |
| Molecular Formula | C30H22O6 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (2Z,9R)-9-(4-oxochromen-3-yl)-2-[(4-propan-2-ylphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | CC(C)c1ccc(/C=C2\Oc3c(ccc4c3[C@H](c3coc5ccccc5c3=O)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C30H22O6/c1-16(2)18-9-7-17(8-10-18)13-25-29(33)20-11-12-24-27(30(20)36-25)21(14-26(31)35-24)22-15-34-23-6-4-3-5-19(23)28(22)32/h3-13,15-16,21H,14H2,1-2H3/b25-13-/t21-/m0/s1 |
| InChIKey | JSANKKKWMLHMFF-CLVGQAISSA-N |
| XLogP | 5.97 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|