C26H18O7 — CID 162976348
2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(4-hydroxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 162976348) has the molecular formula C26H18O7 and a molecular weight of 442.42 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(4-hydroxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(4-hydroxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 162976348 |
| Molecular Formula | C26H18O7 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(4-hydroxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1CC(c2ccc(O)cc2)c2c(ccc3c2OC(=Cc2ccc4c(c2)OCCO4)C3=O)O1 |
| InChI | InChI=1S/C26H18O7/c27-16-4-2-15(3-5-16)18-13-23(28)32-20-8-6-17-25(29)22(33-26(17)24(18)20)12-14-1-7-19-21(11-14)31-10-9-30-19/h1-8,11-12,18,27H,9-10,13H2 |
| InChIKey | QKQZUNJZOQODTH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|