C28H20O9 — CID 110206492
(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(7-methoxy-1,3-benzodioxol-5-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 110206492) has the molecular formula C28H20O9 and a molecular weight of 500.46 g/mol. Its IUPAC name is (2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(7-methoxy-1,3-benzodioxol-5-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(7-methoxy-1,3-benzodioxol-5-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 110206492 |
| Molecular Formula | C28H20O9 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | (2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(7-methoxy-1,3-benzodioxol-5-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cc(C2CC(=O)Oc3ccc4c(c32)O/C(=C\c2ccc3c(c2)OCCO3)C4=O)cc2c1OCO2 |
| InChI | InChI=1S/C28H20O9/c1-31-22-10-15(11-23-28(22)35-13-34-23)17-12-24(29)36-19-5-3-16-26(30)21(37-27(16)25(17)19)9-14-2-4-18-20(8-14)33-7-6-32-18/h2-5,8-11,17H,6-7,12-13H2,1H3/b21-9- |
| InChIKey | UHQQSVJSAYYPSJ-NKVSQWTQSA-N |
| XLogP | 4.25 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|