C28H20O8 — CID 163091151
methyl 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoate (PubChem CID 163091151) has the molecular formula C28H20O8 and a molecular weight of 484.46 g/mol. Its IUPAC name is methyl 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoate.
| Compound Name | methyl 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoate |
|---|---|
| PubChem CID | 163091151 |
| Molecular Formula | C28H20O8 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | methyl 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2CC(=O)Oc3ccc4c(c32)OC(=Cc2ccc3c(c2)OCCO3)C4=O)cc1 |
| InChI | InChI=1S/C28H20O8/c1-32-28(31)17-5-3-16(4-6-17)19-14-24(29)35-21-9-7-18-26(30)23(36-27(18)25(19)21)13-15-2-8-20-22(12-15)34-11-10-33-20/h2-9,12-13,19H,10-11,14H2,1H3 |
| InChIKey | SOSIAPSNEKANNA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|