C26H15F3O6 — CID 124876181
(2Z,9R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(3,4,5-trifluorophenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124876181) has the molecular formula C26H15F3O6 and a molecular weight of 480.39 g/mol. Its IUPAC name is (2Z,9R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(3,4,5-trifluorophenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(3,4,5-trifluorophenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124876181 |
| Molecular Formula | C26H15F3O6 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (2Z,9R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-(3,4,5-trifluorophenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1C[C@H](c2cc(F)c(F)c(F)c2)c2c(ccc3c2O/C(=C\c2ccc4c(c2)OCCO4)C3=O)O1 |
| InChI | InChI=1S/C26H15F3O6/c27-16-9-13(10-17(28)24(16)29)15-11-22(30)34-19-4-2-14-25(31)21(35-26(14)23(15)19)8-12-1-3-18-20(7-12)33-6-5-32-18/h1-4,7-10,15H,5-6,11H2/b21-8-/t15-/m1/s1 |
| InChIKey | FEDYOBAEGWLQOW-PMPIUGFUSA-N |
| XLogP | 4.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|