C23H12F3NO4 — CID 124879049
(2Z,9R)-9-pyridin-4-yl-2-[(3,4,5-trifluorophenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124879049) has the molecular formula C23H12F3NO4 and a molecular weight of 423.35 g/mol. Its IUPAC name is (2Z,9R)-9-pyridin-4-yl-2-[(3,4,5-trifluorophenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-pyridin-4-yl-2-[(3,4,5-trifluorophenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124879049 |
| Molecular Formula | C23H12F3NO4 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | (2Z,9R)-9-pyridin-4-yl-2-[(3,4,5-trifluorophenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1C[C@H](c2ccncc2)c2c(ccc3c2O/C(=C\c2cc(F)c(F)c(F)c2)C3=O)O1 |
| InChI | InChI=1S/C23H12F3NO4/c24-15-7-11(8-16(25)21(15)26)9-18-22(29)13-1-2-17-20(23(13)31-18)14(10-19(28)30-17)12-3-5-27-6-4-12/h1-9,14H,10H2/b18-9-/t14-/m1/s1 |
| InChIKey | PETOVOZHIMXHSX-BBSXFRJVSA-N |
| XLogP | 4.56 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|