C25H27NO5 — CID 95023403
prop-2-enyl 2-[[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]acetate (PubChem CID 95023403) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is prop-2-enyl 2-[[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]acetate.
| Compound Name | prop-2-enyl 2-[[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 95023403 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | prop-2-enyl 2-[[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]acetate |
| SMILES | C=CCOC(=O)COc1ccc2c(c1C)O/C(=C\c1ccc(N(CC)CC)cc1)C2=O |
| InChI | InChI=1S/C25H27NO5/c1-5-14-29-23(27)16-30-21-13-12-20-24(28)22(31-25(20)17(21)4)15-18-8-10-19(11-9-18)26(6-2)7-3/h5,8-13,15H,1,6-7,14,16H2,2-4H3/b22-15- |
| InChIKey | JNWOXEMSKRMIMH-JCMHNJIXSA-N |
| XLogP | 4.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|