C25H18BrNO7 — CID 95398848
(2Z)-6-[(6-bromo-4H-1,3-benzodioxin-8-yl)methoxy]-4-methyl-2-[(3-nitrophenyl)methylidene]-1-benzofuran-3-one (PubChem CID 95398848) has the molecular formula C25H18BrNO7 and a molecular weight of 524.32 g/mol. Its IUPAC name is (2Z)-6-[(6-bromo-4H-1,3-benzodioxin-8-yl)methoxy]-4-methyl-2-[(3-nitrophenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(6-bromo-4H-1,3-benzodioxin-8-yl)methoxy]-4-methyl-2-[(3-nitrophenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95398848 |
| Molecular Formula | C25H18BrNO7 |
| Molecular Weight | 524.32 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | (2Z)-6-[(6-bromo-4H-1,3-benzodioxin-8-yl)methoxy]-4-methyl-2-[(3-nitrophenyl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1cc(OCc2cc(Br)cc3c2OCOC3)cc2c1C(=O)/C(=C/c1cccc([N+](=O)[O-])c1)O2 |
| InChI | InChI=1S/C25H18BrNO7/c1-14-5-20(32-12-17-9-18(26)8-16-11-31-13-33-25(16)17)10-21-23(14)24(28)22(34-21)7-15-3-2-4-19(6-15)27(29)30/h2-10H,11-13H2,1H3/b22-7- |
| InChIKey | BOBCQIRURPMCOG-HOEBFWFUSA-N |
| XLogP | 5.73 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.32 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|