C27H23ClO7 — CID 110274295
[(2Z)-4-methyl-3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-chloro-2-phenylacetate (PubChem CID 110274295) has the molecular formula C27H23ClO7 and a molecular weight of 494.93 g/mol. Its IUPAC name is [(2Z)-4-methyl-3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-chloro-2-phenylacetate.
| Compound Name | [(2Z)-4-methyl-3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-chloro-2-phenylacetate |
|---|---|
| PubChem CID | 110274295 |
| Molecular Formula | C27H23ClO7 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | [(2Z)-4-methyl-3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-chloro-2-phenylacetate |
| SMILES | COc1ccc(/C=C2\Oc3cc(OC(=O)C(Cl)c4ccccc4)cc(C)c3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C27H23ClO7/c1-15-12-18(34-27(30)23(28)16-8-6-5-7-9-16)14-20-22(15)24(29)21(35-20)13-17-10-11-19(31-2)26(33-4)25(17)32-3/h5-14,23H,1-4H3/b21-13- |
| InChIKey | VIZPDWOKCFUAHQ-BKUYFWCQSA-N |
| XLogP | 5.52 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|