C27H22O7 — CID 3748068
[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3-phenylprop-2-enoate (PubChem CID 3748068) has the molecular formula C27H22O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is [3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3-phenylprop-2-enoate.
| Compound Name | [3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 3748068 |
| Molecular Formula | C27H22O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3-phenylprop-2-enoate |
| SMILES | COc1ccc(C=C2Oc3cc(OC(=O)C=Cc4ccccc4)ccc3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C27H22O7/c1-30-21-13-10-18(26(31-2)27(21)32-3)15-23-25(29)20-12-11-19(16-22(20)34-23)33-24(28)14-9-17-7-5-4-6-8-17/h4-16H,1-3H3 |
| InChIKey | JCCGGKNCZPSMSE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|