C26H24O6 — CID 4266889
6-[(2-methylphenyl)methoxy]-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 4266889) has the molecular formula C26H24O6 and a molecular weight of 432.47 g/mol. Its IUPAC name is 6-[(2-methylphenyl)methoxy]-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[(2-methylphenyl)methoxy]-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4266889 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 6-[(2-methylphenyl)methoxy]-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc(C=C2Oc3cc(OCc4ccccc4C)ccc3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C26H24O6/c1-16-7-5-6-8-18(16)15-31-19-10-11-20-22(14-19)32-23(24(20)27)13-17-9-12-21(28-2)26(30-4)25(17)29-3/h5-14H,15H2,1-4H3 |
| InChIKey | BKSNWGNCCZWSPH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|