C27H24O8 — CID 3538742
benzyl 2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetate (PubChem CID 3538742) has the molecular formula C27H24O8 and a molecular weight of 476.48 g/mol. Its IUPAC name is benzyl 2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetate.
| Compound Name | benzyl 2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 3538742 |
| Molecular Formula | C27H24O8 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | benzyl 2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetate |
| SMILES | COc1ccc(C=C2Oc3cc(OCC(=O)OCc4ccccc4)ccc3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C27H24O8/c1-30-21-12-9-18(26(31-2)27(21)32-3)13-23-25(29)20-11-10-19(14-22(20)35-23)33-16-24(28)34-15-17-7-5-4-6-8-17/h4-14H,15-16H2,1-3H3 |
| InChIKey | SVGAXVGOZVYXPX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|