C25H20Cl2O6 — CID 3881463
6-[(2,4-dichlorophenyl)methoxy]-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 3881463) has the molecular formula C25H20Cl2O6 and a molecular weight of 487.34 g/mol. Its IUPAC name is 6-[(2,4-dichlorophenyl)methoxy]-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[(2,4-dichlorophenyl)methoxy]-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 3881463 |
| Molecular Formula | C25H20Cl2O6 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 6-[(2,4-dichlorophenyl)methoxy]-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc(C=C2Oc3cc(OCc4ccc(Cl)cc4Cl)ccc3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C25H20Cl2O6/c1-29-20-9-5-14(24(30-2)25(20)31-3)10-22-23(28)18-8-7-17(12-21(18)33-22)32-13-15-4-6-16(26)11-19(15)27/h4-12H,13H2,1-3H3 |
| InChIKey | GGQCIHISWBXCPA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|