C24H20O3 — CID 6532546
(2Z)-6-[(2-methylphenyl)methoxy]-2-[(3-methylphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 6532546) has the molecular formula C24H20O3 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2Z)-6-[(2-methylphenyl)methoxy]-2-[(3-methylphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(2-methylphenyl)methoxy]-2-[(3-methylphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6532546 |
| Molecular Formula | C24H20O3 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2Z)-6-[(2-methylphenyl)methoxy]-2-[(3-methylphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1cccc(/C=C2\Oc3cc(OCc4ccccc4C)ccc3C2=O)c1 |
| InChI | InChI=1S/C24H20O3/c1-16-6-5-8-18(12-16)13-23-24(25)21-11-10-20(14-22(21)27-23)26-15-19-9-4-3-7-17(19)2/h3-14H,15H2,1-2H3/b23-13- |
| InChIKey | WNTSUYUDYAXGJI-QRVIBDJDSA-N |
| XLogP | 5.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|