C25H22O4 — CID 5265656
6-[(2,5-dimethylphenyl)methoxy]-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 5265656) has the molecular formula C25H22O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 6-[(2,5-dimethylphenyl)methoxy]-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[(2,5-dimethylphenyl)methoxy]-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5265656 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 6-[(2,5-dimethylphenyl)methoxy]-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1cccc(C=C2Oc3cc(OCc4cc(C)ccc4C)ccc3C2=O)c1 |
| InChI | InChI=1S/C25H22O4/c1-16-7-8-17(2)19(11-16)15-28-21-9-10-22-23(14-21)29-24(25(22)26)13-18-5-4-6-20(12-18)27-3/h4-14H,15H2,1-3H3 |
| InChIKey | DBWKWGOWVJMHAX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|